C15H17F3N2O — CID 90029541
(4S,4aR,8aR)-5,5-difluoro-4-(2-fluorophenyl)-4-methyl-6,7,8,8a-tetrahydro-4aH-1,3-benzoxazin-2-amine (PubChem CID 90029541) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is (4S,4aR,8aR)-5,5-difluoro-4-(2-fluorophenyl)-4-methyl-6,7,8,8a-tetrahydro-4aH-1,3-benzoxazin-2-amine.
| Compound Name | (4S,4aR,8aR)-5,5-difluoro-4-(2-fluorophenyl)-4-methyl-6,7,8,8a-tetrahydro-4aH-1,3-benzoxazin-2-amine |
|---|---|
| PubChem CID | 90029541 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (4S,4aR,8aR)-5,5-difluoro-4-(2-fluorophenyl)-4-methyl-6,7,8,8a-tetrahydro-4aH-1,3-benzoxazin-2-amine |
| SMILES | C[C@]1(c2ccccc2F)N=C(N)O[C@@H]2CCCC(F)(F)[C@@H]21 |
| InChI | InChI=1S/C15H17F3N2O/c1-14(9-5-2-3-6-10(9)16)12-11(21-13(19)20-14)7-4-8-15(12,17)18/h2-3,5-6,11-12H,4,7-8H2,1H3,(H2,19,20)/t11-,12+,14-/m1/s1 |
| InChIKey | OYLYXBNEIFXEMD-MBNYWOFBSA-N |
| XLogP | 3.19 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |