C16H18F4N2O2 — CID 123475308
6-ethenyl-4-(2-fluorophenyl)-4-methyl-5-(2,2,2-trifluoroethoxymethyl)-5,6-dihydro-1,3-oxazin-2-amine (PubChem CID 123475308) has the molecular formula C16H18F4N2O2 and a molecular weight of 346.32 g/mol. Its IUPAC name is 6-ethenyl-4-(2-fluorophenyl)-4-methyl-5-(2,2,2-trifluoroethoxymethyl)-5,6-dihydro-1,3-oxazin-2-amine.
| Compound Name | 6-ethenyl-4-(2-fluorophenyl)-4-methyl-5-(2,2,2-trifluoroethoxymethyl)-5,6-dihydro-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 123475308 |
| Molecular Formula | C16H18F4N2O2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 6-ethenyl-4-(2-fluorophenyl)-4-methyl-5-(2,2,2-trifluoroethoxymethyl)-5,6-dihydro-1,3-oxazin-2-amine |
| SMILES | C=CC1OC(N)=NC(C)(c2ccccc2F)C1COCC(F)(F)F |
| InChI | InChI=1S/C16H18F4N2O2/c1-3-13-11(8-23-9-16(18,19)20)15(2,22-14(21)24-13)10-6-4-5-7-12(10)17/h3-7,11,13H,1,8-9H2,2H3,(H2,21,22) |
| InChIKey | JWHLINNLOUADJY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|