C15H18FN3O4S — CID 66562256
(3R)-3-(2-fluoro-5-nitrophenyl)-3,6-dimethyl-1,1-dioxo-6-prop-2-enyl-2H-1,4-thiazin-5-amine (PubChem CID 66562256) has the molecular formula C15H18FN3O4S and a molecular weight of 355.39 g/mol. Its IUPAC name is (3R)-3-(2-fluoro-5-nitrophenyl)-3,6-dimethyl-1,1-dioxo-6-prop-2-enyl-2H-1,4-thiazin-5-amine.
| Compound Name | (3R)-3-(2-fluoro-5-nitrophenyl)-3,6-dimethyl-1,1-dioxo-6-prop-2-enyl-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 66562256 |
| Molecular Formula | C15H18FN3O4S |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (3R)-3-(2-fluoro-5-nitrophenyl)-3,6-dimethyl-1,1-dioxo-6-prop-2-enyl-2H-1,4-thiazin-5-amine |
| SMILES | C=CCC1(C)C(N)=N[C@](C)(c2cc([N+](=O)[O-])ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C15H18FN3O4S/c1-4-7-15(3)13(17)18-14(2,9-24(15,22)23)11-8-10(19(20)21)5-6-12(11)16/h4-6,8H,1,7,9H2,2-3H3,(H2,17,18)/t14-,15?/m0/s1 |
| InChIKey | BXLTZLVMZNMADB-MLCCFXAWSA-N |
| XLogP | 2.07 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|