C19H20FN3O4S — CID 122705735
(3R,6S)-3-(2-fluoro-5-nitrophenyl)-3,6-dimethyl-6-(3-methylphenyl)-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 122705735) has the molecular formula C19H20FN3O4S and a molecular weight of 405.45 g/mol. Its IUPAC name is (3R,6S)-3-(2-fluoro-5-nitrophenyl)-3,6-dimethyl-6-(3-methylphenyl)-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R,6S)-3-(2-fluoro-5-nitrophenyl)-3,6-dimethyl-6-(3-methylphenyl)-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 122705735 |
| Molecular Formula | C19H20FN3O4S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (3R,6S)-3-(2-fluoro-5-nitrophenyl)-3,6-dimethyl-6-(3-methylphenyl)-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | Cc1cccc([C@@]2(C)C(N)=N[C@](C)(c3cc([N+](=O)[O-])ccc3F)CS2(=O)=O)c1 |
| InChI | InChI=1S/C19H20FN3O4S/c1-12-5-4-6-13(9-12)19(3)17(21)22-18(2,11-28(19,26)27)15-10-14(23(24)25)7-8-16(15)20/h4-10H,11H2,1-3H3,(H2,21,22)/t18-,19-/m0/s1 |
| InChIKey | LTABOTDLARYFAZ-OALUTQOASA-N |
| XLogP | 2.96 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|