C13H15BrFN3O2S — CID 129201667
(4aR,7aR)-4a-(5-bromo-2-fluorophenyl)-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-amine (PubChem CID 129201667) has the molecular formula C13H15BrFN3O2S and a molecular weight of 376.25 g/mol. Its IUPAC name is (4aR,7aR)-4a-(5-bromo-2-fluorophenyl)-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-amine.
| Compound Name | (4aR,7aR)-4a-(5-bromo-2-fluorophenyl)-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-amine |
|---|---|
| PubChem CID | 129201667 |
| Molecular Formula | C13H15BrFN3O2S |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | (4aR,7aR)-4a-(5-bromo-2-fluorophenyl)-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@@]2(c3cc(Br)ccc3F)CCC[C@H]2S1(=O)=O |
| InChI | InChI=1S/C13H15BrFN3O2S/c1-18-12(16)17-13(6-2-3-11(13)21(18,19)20)9-7-8(14)4-5-10(9)15/h4-5,7,11H,2-3,6H2,1H3,(H2,16,17)/t11-,13-/m1/s1 |
| InChIKey | NXEADWGYONCQHR-DGCLKSJQSA-N |
| XLogP | 1.93 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |