C18H25FN4O4S — CID 129201651
tert-butyl N-[(4aR,7aR)-4a-(5-amino-2-fluorophenyl)-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-yl]carbamate (PubChem CID 129201651) has the molecular formula C18H25FN4O4S and a molecular weight of 412.49 g/mol. Its IUPAC name is tert-butyl N-[(4aR,7aR)-4a-(5-amino-2-fluorophenyl)-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(4aR,7aR)-4a-(5-amino-2-fluorophenyl)-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 129201651 |
| Molecular Formula | C18H25FN4O4S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | tert-butyl N-[(4aR,7aR)-4a-(5-amino-2-fluorophenyl)-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-yl]carbamate |
| SMILES | CN1C(NC(=O)OC(C)(C)C)=N[C@@]2(c3cc(N)ccc3F)CCC[C@H]2S1(=O)=O |
| InChI | InChI=1S/C18H25FN4O4S/c1-17(2,3)27-16(24)21-15-22-18(12-10-11(20)7-8-13(12)19)9-5-6-14(18)28(25,26)23(15)4/h7-8,10,14H,5-6,9,20H2,1-4H3,(H,21,22,24)/t14-,18-/m1/s1 |
| InChIKey | QLKWUHPJSGVTDB-RDTXWAMCSA-N |
| XLogP | 2.31 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|