C19H25FN4O5S — CID 129202341
tert-butyl N-[4a-(5-amino-2-fluorophenyl)-2-methyl-1,1,7-trioxo-5,6,8,8a-tetrahydro-1λ6,2,4-benzothiadiazin-3-yl]carbamate (PubChem CID 129202341) has the molecular formula C19H25FN4O5S and a molecular weight of 440.50 g/mol. Its IUPAC name is tert-butyl N-[4a-(5-amino-2-fluorophenyl)-2-methyl-1,1,7-trioxo-5,6,8,8a-tetrahydro-1λ6,2,4-benzothiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[4a-(5-amino-2-fluorophenyl)-2-methyl-1,1,7-trioxo-5,6,8,8a-tetrahydro-1λ6,2,4-benzothiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 129202341 |
| Molecular Formula | C19H25FN4O5S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | tert-butyl N-[4a-(5-amino-2-fluorophenyl)-2-methyl-1,1,7-trioxo-5,6,8,8a-tetrahydro-1λ6,2,4-benzothiadiazin-3-yl]carbamate |
| SMILES | CN1C(NC(=O)OC(C)(C)C)=NC2(c3cc(N)ccc3F)CCC(=O)CC2S1(=O)=O |
| InChI | InChI=1S/C19H25FN4O5S/c1-18(2,3)29-17(26)22-16-23-19(13-9-11(21)5-6-14(13)20)8-7-12(25)10-15(19)30(27,28)24(16)4/h5-6,9,15H,7-8,10,21H2,1-4H3,(H,22,23,26) |
| InChIKey | WHYGVKUUJYYTPJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|