C18H25FN4O3S — CID 145323244
tert-butyl N-[4a-(5-amino-2-fluorophenyl)-2-methyl-1-oxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-yl]carbamate (PubChem CID 145323244) has the molecular formula C18H25FN4O3S and a molecular weight of 396.49 g/mol. Its IUPAC name is tert-butyl N-[4a-(5-amino-2-fluorophenyl)-2-methyl-1-oxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[4a-(5-amino-2-fluorophenyl)-2-methyl-1-oxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 145323244 |
| Molecular Formula | C18H25FN4O3S |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | tert-butyl N-[4a-(5-amino-2-fluorophenyl)-2-methyl-1-oxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-yl]carbamate |
| SMILES | CN1C(NC(=O)OC(C)(C)C)=NC2(c3cc(N)ccc3F)CCCC2S1=O |
| InChI | InChI=1S/C18H25FN4O3S/c1-17(2,3)26-16(24)21-15-22-18(12-10-11(20)7-8-13(12)19)9-5-6-14(18)27(25)23(15)4/h7-8,10,14H,5-6,9,20H2,1-4H3,(H,21,22,24) |
| InChIKey | QPKINGVYNVXMLK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|