C15H20FN3O3 — CID 125499635
tert-butyl N-[(4S)-4-(5-amino-2-fluorophenyl)-4-methyl-5H-1,3-oxazol-2-yl]carbamate (PubChem CID 125499635) has the molecular formula C15H20FN3O3 and a molecular weight of 309.34 g/mol. Its IUPAC name is tert-butyl N-[(4S)-4-(5-amino-2-fluorophenyl)-4-methyl-5H-1,3-oxazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4S)-4-(5-amino-2-fluorophenyl)-4-methyl-5H-1,3-oxazol-2-yl]carbamate |
|---|---|
| PubChem CID | 125499635 |
| Molecular Formula | C15H20FN3O3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | tert-butyl N-[(4S)-4-(5-amino-2-fluorophenyl)-4-methyl-5H-1,3-oxazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@@](C)(c2cc(N)ccc2F)CO1 |
| InChI | InChI=1S/C15H20FN3O3/c1-14(2,3)22-13(20)18-12-19-15(4,8-21-12)10-7-9(17)5-6-11(10)16/h5-7H,8,17H2,1-4H3,(H,18,19,20)/t15-/m1/s1 |
| InChIKey | FQQJJXKNAMOFIM-OAHLLOKOSA-N |
| XLogP | 2.53 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|