C16H21F2N3O3 — CID 66665357
tert-butyl N-[(5R)-5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]carbamate (PubChem CID 66665357) has the molecular formula C16H21F2N3O3 and a molecular weight of 341.36 g/mol. Its IUPAC name is tert-butyl N-[(5R)-5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(5R)-5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]carbamate |
|---|---|
| PubChem CID | 66665357 |
| Molecular Formula | C16H21F2N3O3 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | tert-butyl N-[(5R)-5-(5-amino-2-fluorophenyl)-5-(fluoromethyl)-2,6-dihydro-1,4-oxazin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@](CF)(c2cc(N)ccc2F)COC1 |
| InChI | InChI=1S/C16H21F2N3O3/c1-15(2,3)24-14(22)20-13-7-23-9-16(8-17,21-13)11-6-10(19)4-5-12(11)18/h4-6H,7-9,19H2,1-3H3,(H,20,21,22)/t16-/m0/s1 |
| InChIKey | ILJMNPZZNISUSI-INIZCTEOSA-N |
| XLogP | 2.53 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|