C22H27N3O3 — CID 89431952
tert-butyl N-[(5S)-5-[3-(3-aminophenyl)phenyl]-5-methyl-2,6-dihydro-1,4-oxazin-3-yl]carbamate (PubChem CID 89431952) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-[3-(3-aminophenyl)phenyl]-5-methyl-2,6-dihydro-1,4-oxazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-[3-(3-aminophenyl)phenyl]-5-methyl-2,6-dihydro-1,4-oxazin-3-yl]carbamate |
|---|---|
| PubChem CID | 89431952 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | tert-butyl N-[(5S)-5-[3-(3-aminophenyl)phenyl]-5-methyl-2,6-dihydro-1,4-oxazin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@@](C)(c2cccc(-c3cccc(N)c3)c2)COC1 |
| InChI | InChI=1S/C22H27N3O3/c1-21(2,3)28-20(26)24-19-13-27-14-22(4,25-19)17-9-5-7-15(11-17)16-8-6-10-18(23)12-16/h5-12H,13-14,23H2,1-4H3,(H,24,25,26)/t22-/m1/s1 |
| InChIKey | SKHSYEROQXHGJX-JOCHJYFZSA-N |
| XLogP | 4.10 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|