C17H21N3O2 — CID 68786363
tert-butyl N-[5-amino-2-(4-aminophenyl)phenyl]carbamate (PubChem CID 68786363) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is tert-butyl N-[5-amino-2-(4-aminophenyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[5-amino-2-(4-aminophenyl)phenyl]carbamate |
|---|---|
| PubChem CID | 68786363 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | tert-butyl N-[5-amino-2-(4-aminophenyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(N)ccc1-c1ccc(N)cc1 |
| InChI | InChI=1S/C17H21N3O2/c1-17(2,3)22-16(21)20-15-10-13(19)8-9-14(15)11-4-6-12(18)7-5-11/h4-10H,18-19H2,1-3H3,(H,20,21) |
| InChIKey | FUZFROBTNCSZCC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|