C19H20N6O2 — CID 159916711
tert-butyl N-[5-amino-2-(6-phenyl-1,2,4,5-tetrazin-3-yl)phenyl]carbamate (PubChem CID 159916711) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is tert-butyl N-[5-amino-2-(6-phenyl-1,2,4,5-tetrazin-3-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[5-amino-2-(6-phenyl-1,2,4,5-tetrazin-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 159916711 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | tert-butyl N-[5-amino-2-(6-phenyl-1,2,4,5-tetrazin-3-yl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(N)ccc1-c1nnc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C19H20N6O2/c1-19(2,3)27-18(26)21-15-11-13(20)9-10-14(15)17-24-22-16(23-25-17)12-7-5-4-6-8-12/h4-11H,20H2,1-3H3,(H,21,26) |
| InChIKey | YYWRFVOGFZEDOH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|