C18H21N6O3+ — CID 174836977
(4-aminobenzoyl)imino-[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]iminoazanium (PubChem CID 174836977) has the molecular formula C18H21N6O3+ and a molecular weight of 369.41 g/mol. Its IUPAC name is (4-aminobenzoyl)imino-[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]iminoazanium.
| Compound Name | (4-aminobenzoyl)imino-[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]iminoazanium |
|---|---|
| PubChem CID | 174836977 |
| Molecular Formula | C18H21N6O3+ |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (4-aminobenzoyl)imino-[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]iminoazanium |
| SMILES | CC(C)(C)OC(=O)Nc1cc(N)ccc1N=[N+]=NC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C18H20N6O3/c1-18(2,3)27-17(26)21-15-10-13(20)8-9-14(15)22-24-23-16(25)11-4-6-12(19)7-5-11/h4-10H,1-3H3,(H4,19,20,21,25,26)/p+1 |
| InChIKey | KXWHAHBYDUUASZ-UHFFFAOYSA-O |
| XLogP | 3.64 |
| TPSA | 146.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|