C14H15F2N5O2 — CID 158823736
tert-butyl N-[difluoro-(6-phenyl-1,2,4,5-tetrazin-3-yl)methyl]carbamate (PubChem CID 158823736) has the molecular formula C14H15F2N5O2 and a molecular weight of 323.30 g/mol. Its IUPAC name is tert-butyl N-[difluoro-(6-phenyl-1,2,4,5-tetrazin-3-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[difluoro-(6-phenyl-1,2,4,5-tetrazin-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 158823736 |
| Molecular Formula | C14H15F2N5O2 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | tert-butyl N-[difluoro-(6-phenyl-1,2,4,5-tetrazin-3-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(F)(F)c1nnc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C14H15F2N5O2/c1-13(2,3)23-12(22)17-14(15,16)11-20-18-10(19-21-11)9-7-5-4-6-8-9/h4-8H,1-3H3,(H,17,22) |
| InChIKey | BUVYYOJXRRBIGD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|