C20H21N5O2 — CID 71605067
tert-butyl N-(4-anilino-6-phenyl-1,3,5-triazin-2-yl)carbamate (PubChem CID 71605067) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is tert-butyl N-(4-anilino-6-phenyl-1,3,5-triazin-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-anilino-6-phenyl-1,3,5-triazin-2-yl)carbamate |
|---|---|
| PubChem CID | 71605067 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | tert-butyl N-(4-anilino-6-phenyl-1,3,5-triazin-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(Nc2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H21N5O2/c1-20(2,3)27-19(26)25-18-23-16(14-10-6-4-7-11-14)22-17(24-18)21-15-12-8-5-9-13-15/h4-13H,1-3H3,(H2,21,22,23,24,25,26) |
| InChIKey | WVQWCLRVOUOCAQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |