C29H35N7 — CID 21331405
2-N,4-N-bis[3-(butylamino)phenyl]-6-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 21331405) has the molecular formula C29H35N7 and a molecular weight of 481.65 g/mol. Its IUPAC name is 2-N,4-N-bis[3-(butylamino)phenyl]-6-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis[3-(butylamino)phenyl]-6-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 21331405 |
| Molecular Formula | C29H35N7 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | 2-N,4-N-bis[3-(butylamino)phenyl]-6-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCNc1cccc(Nc2nc(Nc3cccc(NCCCC)c3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C29H35N7/c1-3-5-18-30-23-14-10-16-25(20-23)32-28-34-27(22-12-8-7-9-13-22)35-29(36-28)33-26-17-11-15-24(21-26)31-19-6-4-2/h7-17,20-21,30-31H,3-6,18-19H2,1-2H3,(H2,32,33,34,35,36) |
| InChIKey | YDUVVXZQERGGTG-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|