C69H113N5O6 — CID 91807023
6-phenyl-2-N,4-N-bis(3,4,5-trioctoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 91807023) has the molecular formula C69H113N5O6 and a molecular weight of 1108.69 g/mol. Its IUPAC name is 6-phenyl-2-N,4-N-bis(3,4,5-trioctoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-phenyl-2-N,4-N-bis(3,4,5-trioctoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 91807023 |
| Molecular Formula | C69H113N5O6 |
| Molecular Weight | 1108.69 g/mol |
| Exact Mass | 1107.87 |
| IUPAC Name | 6-phenyl-2-N,4-N-bis(3,4,5-trioctoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCCCOc1cc(Nc2nc(Nc3cc(OCCCCCCCC)c(OCCCCCCCC)c(OCCCCCCCC)c3)nc(-c3ccccc3)n2)cc(OCCCCCCCC)c1OCCCCCCCC |
| InChI | InChI=1S/C69H113N5O6/c1-7-13-19-25-31-40-48-75-61-54-59(55-62(76-49-41-32-26-20-14-8-2)65(61)79-52-44-35-29-23-17-11-5)70-68-72-67(58-46-38-37-39-47-58)73-69(74-68)71-60-56-63(77-50-42-33-27-21-15-9-3)66(80-53-45-36-30-24-18-12-6)64(57-60)78-51-43-34-28-22-16-10-4/h37-39,46-47,54-57H,7-36,40-45,48-53H2,1-6H3,(H2,70,71,72,73,74) |
| InChIKey | KGYSUEAZPRZJDW-UHFFFAOYSA-N |
| XLogP | 21.46 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.69 |
| LogP ≤ 5 | 21.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|