C71H117N5O6 — CID 87802596
6-(4-ethylphenyl)-2-N,4-N-bis(3,4,5-trioctoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 87802596) has the molecular formula C71H117N5O6 and a molecular weight of 1136.75 g/mol. Its IUPAC name is 6-(4-ethylphenyl)-2-N,4-N-bis(3,4,5-trioctoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(4-ethylphenyl)-2-N,4-N-bis(3,4,5-trioctoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 87802596 |
| Molecular Formula | C71H117N5O6 |
| Molecular Weight | 1136.75 g/mol |
| Exact Mass | 1135.90 |
| IUPAC Name | 6-(4-ethylphenyl)-2-N,4-N-bis(3,4,5-trioctoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCCCOc1cc(Nc2nc(Nc3cc(OCCCCCCCC)c(OCCCCCCCC)c(OCCCCCCCC)c3)nc(-c3ccc(CC)cc3)n2)cc(OCCCCCCCC)c1OCCCCCCCC |
| InChI | InChI=1S/C71H117N5O6/c1-8-15-21-27-33-39-49-77-63-55-61(56-64(78-50-40-34-28-22-16-9-2)67(63)81-53-43-37-31-25-19-12-5)72-70-74-69(60-47-45-59(14-7)46-48-60)75-71(76-70)73-62-57-65(79-51-41-35-29-23-17-10-3)68(82-54-44-38-32-26-20-13-6)66(58-62)80-52-42-36-30-24-18-11-4/h45-48,55-58H,8-44,49-54H2,1-7H3,(H2,72,73,74,75,76) |
| InChIKey | OHHHCJGJTPELMD-UHFFFAOYSA-N |
| XLogP | 22.02 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1136.75 |
| LogP ≤ 5 | 22.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|