C70H111BrN2O6 — CID 102332700
4-(4-bromophenyl)-2,6-bis(3,4,5-trioctoxyphenyl)pyrimidine (PubChem CID 102332700) has the molecular formula C70H111BrN2O6 and a molecular weight of 1156.57 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2,6-bis(3,4,5-trioctoxyphenyl)pyrimidine.
| Compound Name | 4-(4-bromophenyl)-2,6-bis(3,4,5-trioctoxyphenyl)pyrimidine |
|---|---|
| PubChem CID | 102332700 |
| Molecular Formula | C70H111BrN2O6 |
| Molecular Weight | 1156.57 g/mol |
| Exact Mass | 1154.76 |
| IUPAC Name | 4-(4-bromophenyl)-2,6-bis(3,4,5-trioctoxyphenyl)pyrimidine |
| SMILES | CCCCCCCCOc1cc(-c2cc(-c3ccc(Br)cc3)nc(-c3cc(OCCCCCCCC)c(OCCCCCCCC)c(OCCCCCCCC)c3)n2)cc(OCCCCCCCC)c1OCCCCCCCC |
| InChI | InChI=1S/C70H111BrN2O6/c1-7-13-19-25-31-37-47-74-64-53-59(54-65(75-48-38-32-26-20-14-8-2)68(64)78-51-41-35-29-23-17-11-5)63-57-62(58-43-45-61(71)46-44-58)72-70(73-63)60-55-66(76-49-39-33-27-21-15-9-3)69(79-52-42-36-30-24-18-12-6)67(56-60)77-50-40-34-28-22-16-10-4/h43-46,53-57H,7-42,47-52H2,1-6H3 |
| InChIKey | YFEMJOULSMRQMO-UHFFFAOYSA-N |
| XLogP | 22.68 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1156.57 |
| LogP ≤ 5 | 22.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|