C96H141N3O12 — CID 102393949
2,4,6-tris[4-[(3,4,5-trihexoxyphenyl)methoxy]phenyl]-1,3,5-triazine (PubChem CID 102393949) has the molecular formula C96H141N3O12 and a molecular weight of 1529.19 g/mol. Its IUPAC name is 2,4,6-tris[4-[(3,4,5-trihexoxyphenyl)methoxy]phenyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[4-[(3,4,5-trihexoxyphenyl)methoxy]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 102393949 |
| Molecular Formula | C96H141N3O12 |
| Molecular Weight | 1529.19 g/mol |
| Exact Mass | 1528.05 |
| IUPAC Name | 2,4,6-tris[4-[(3,4,5-trihexoxyphenyl)methoxy]phenyl]-1,3,5-triazine |
| SMILES | CCCCCCOc1cc(COc2ccc(-c3nc(-c4ccc(OCc5cc(OCCCCCC)c(OCCCCCC)c(OCCCCCC)c5)cc4)nc(-c4ccc(OCc5cc(OCCCCCC)c(OCCCCCC)c(OCCCCCC)c5)cc4)n3)cc2)cc(OCCCCCC)c1OCCCCCC |
| InChI | InChI=1S/C96H141N3O12/c1-10-19-28-37-58-100-85-67-76(68-86(101-59-38-29-20-11-2)91(85)106-64-43-34-25-16-7)73-109-82-52-46-79(47-53-82)94-97-95(80-48-54-83(55-49-80)110-74-77-69-87(102-60-39-30-21-12-3)92(107-65-44-35-26-17-8)88(70-77)103-61-40-31-22-13-4)99-96(98-94)81-50-56-84(57-51-81)111-75-78-71-89(104-62-41-32-23-14-5)93(108-66-45-36-27-18-9)90(72-78)105-63-42-33-24-15-6/h46-57,67-72H,10-45,58-66,73-75H2,1-9H3 |
| InChIKey | XJVRORFFZVOJLH-UHFFFAOYSA-N |
| XLogP | 27.24 |
| TPSA | 149.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 66 |
| Heavy Atoms | 111 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1529.19 |
| LogP ≤ 5 | 27.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|