C50H77N5O4S — CID 102224817
6-[5-[4-[(3,4,5-tris-decoxyphenyl)methoxy]phenyl]thiophen-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 102224817) has the molecular formula C50H77N5O4S and a molecular weight of 844.26 g/mol. Its IUPAC name is 6-[5-[4-[(3,4,5-tris-decoxyphenyl)methoxy]phenyl]thiophen-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[5-[4-[(3,4,5-tris-decoxyphenyl)methoxy]phenyl]thiophen-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 102224817 |
| Molecular Formula | C50H77N5O4S |
| Molecular Weight | 844.26 g/mol |
| Exact Mass | 843.57 |
| IUPAC Name | 6-[5-[4-[(3,4,5-tris-decoxyphenyl)methoxy]phenyl]thiophen-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCCCCCOc1cc(COc2ccc(-c3ccc(-c4nc(N)nc(N)n4)s3)cc2)cc(OCCCCCCCCCC)c1OCCCCCCCCCC |
| InChI | InChI=1S/C50H77N5O4S/c1-4-7-10-13-16-19-22-25-34-56-43-37-40(39-59-42-30-28-41(29-31-42)45-32-33-46(60-45)48-53-49(51)55-50(52)54-48)38-44(57-35-26-23-20-17-14-11-8-5-2)47(43)58-36-27-24-21-18-15-12-9-6-3/h28-33,37-38H,4-27,34-36,39H2,1-3H3,(H4,51,52,53,54,55) |
| InChIKey | SLPFIDIRVCCFJP-UHFFFAOYSA-N |
| XLogP | 14.57 |
| TPSA | 127.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.26 |
| LogP ≤ 5 | 14.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|