C99H144O12 — CID 102393948
5-[[4-[3,5-bis[4-[(3,4,5-trihexoxyphenyl)methoxy]phenyl]phenyl]phenoxy]methyl]-1,2,3-trihexoxybenzene (PubChem CID 102393948) has the molecular formula C99H144O12 and a molecular weight of 1526.23 g/mol. Its IUPAC name is 5-[[4-[3,5-bis[4-[(3,4,5-trihexoxyphenyl)methoxy]phenyl]phenyl]phenoxy]methyl]-1,2,3-trihexoxybenzene.
| Compound Name | 5-[[4-[3,5-bis[4-[(3,4,5-trihexoxyphenyl)methoxy]phenyl]phenyl]phenoxy]methyl]-1,2,3-trihexoxybenzene |
|---|---|
| PubChem CID | 102393948 |
| Molecular Formula | C99H144O12 |
| Molecular Weight | 1526.23 g/mol |
| Exact Mass | 1525.07 |
| IUPAC Name | 5-[[4-[3,5-bis[4-[(3,4,5-trihexoxyphenyl)methoxy]phenyl]phenyl]phenoxy]methyl]-1,2,3-trihexoxybenzene |
| SMILES | CCCCCCOc1cc(COc2ccc(-c3cc(-c4ccc(OCc5cc(OCCCCCC)c(OCCCCCC)c(OCCCCCC)c5)cc4)cc(-c4ccc(OCc5cc(OCCCCCC)c(OCCCCCC)c(OCCCCCC)c5)cc4)c3)cc2)cc(OCCCCCC)c1OCCCCCC |
| InChI | InChI=1S/C99H144O12/c1-10-19-28-37-58-100-91-67-79(68-92(101-59-38-29-20-11-2)97(91)106-64-43-34-25-16-7)76-109-88-52-46-82(47-53-88)85-73-86(83-48-54-89(55-49-83)110-77-80-69-93(102-60-39-30-21-12-3)98(107-65-44-35-26-17-8)94(70-80)103-61-40-31-22-13-4)75-87(74-85)84-50-56-90(57-51-84)111-78-81-71-95(104-62-41-32-23-14-5)99(108-66-45-36-27-18-9)96(72-81)105-63-42-33-24-15-6/h46-57,67-75H,10-45,58-66,76-78H2,1-9H3 |
| InChIKey | OJDIFZLBEVVHIV-UHFFFAOYSA-N |
| XLogP | 29.06 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 66 |
| Heavy Atoms | 111 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1526.23 |
| LogP ≤ 5 | 29.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|