C72H72O12 — CID 102493215
5-[[4-[3,5-bis[4-[[3,4,5-tris(prop-2-enoxy)phenyl]methoxy]phenyl]phenyl]phenoxy]methyl]-1,2,3-tris(prop-2-enoxy)benzene (PubChem CID 102493215) has the molecular formula C72H72O12 and a molecular weight of 1129.36 g/mol. Its IUPAC name is 5-[[4-[3,5-bis[4-[[3,4,5-tris(prop-2-enoxy)phenyl]methoxy]phenyl]phenyl]phenoxy]methyl]-1,2,3-tris(prop-2-enoxy)benzene.
| Compound Name | 5-[[4-[3,5-bis[4-[[3,4,5-tris(prop-2-enoxy)phenyl]methoxy]phenyl]phenyl]phenoxy]methyl]-1,2,3-tris(prop-2-enoxy)benzene |
|---|---|
| PubChem CID | 102493215 |
| Molecular Formula | C72H72O12 |
| Molecular Weight | 1129.36 g/mol |
| Exact Mass | 1128.50 |
| IUPAC Name | 5-[[4-[3,5-bis[4-[[3,4,5-tris(prop-2-enoxy)phenyl]methoxy]phenyl]phenyl]phenoxy]methyl]-1,2,3-tris(prop-2-enoxy)benzene |
| SMILES | C=CCOc1cc(COc2ccc(-c3cc(-c4ccc(OCc5cc(OCC=C)c(OCC=C)c(OCC=C)c5)cc4)cc(-c4ccc(OCc5cc(OCC=C)c(OCC=C)c(OCC=C)c5)cc4)c3)cc2)cc(OCC=C)c1OCC=C |
| InChI | InChI=1S/C72H72O12/c1-10-31-73-64-40-52(41-65(74-32-11-2)70(64)79-37-16-7)49-82-61-25-19-55(20-26-61)58-46-59(56-21-27-62(28-22-56)83-50-53-42-66(75-33-12-3)71(80-38-17-8)67(43-53)76-34-13-4)48-60(47-58)57-23-29-63(30-24-57)84-51-54-44-68(77-35-14-5)72(81-39-18-9)69(45-54)78-36-15-6/h10-30,40-48H,1-9,31-39,49-51H2 |
| InChIKey | GRUOUHWVQSKVBA-UHFFFAOYSA-N |
| XLogP | 16.51 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1129.36 |
| LogP ≤ 5 | 16.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|