C17H15N5O2 — CID 117092961
4-(4-anilino-6-methoxy-1,3,5-triazin-2-yl)benzamide (PubChem CID 117092961) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is 4-(4-anilino-6-methoxy-1,3,5-triazin-2-yl)benzamide.
| Compound Name | 4-(4-anilino-6-methoxy-1,3,5-triazin-2-yl)benzamide |
|---|---|
| PubChem CID | 117092961 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 4-(4-anilino-6-methoxy-1,3,5-triazin-2-yl)benzamide |
| SMILES | COc1nc(Nc2ccccc2)nc(-c2ccc(C(N)=O)cc2)n1 |
| InChI | InChI=1S/C17H15N5O2/c1-24-17-21-15(12-9-7-11(8-10-12)14(18)23)20-16(22-17)19-13-5-3-2-4-6-13/h2-10H,1H3,(H2,18,23)(H,19,20,21,22) |
| InChIKey | YEGGZQFQFAJAQS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |