C14H15N5O2 — CID 117092347
4-[4-(cyclopropylamino)-6-methoxy-1,3,5-triazin-2-yl]benzamide (PubChem CID 117092347) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 4-[4-(cyclopropylamino)-6-methoxy-1,3,5-triazin-2-yl]benzamide.
| Compound Name | 4-[4-(cyclopropylamino)-6-methoxy-1,3,5-triazin-2-yl]benzamide |
|---|---|
| PubChem CID | 117092347 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-[4-(cyclopropylamino)-6-methoxy-1,3,5-triazin-2-yl]benzamide |
| SMILES | COc1nc(NC2CC2)nc(-c2ccc(C(N)=O)cc2)n1 |
| InChI | InChI=1S/C14H15N5O2/c1-21-14-18-12(17-13(19-14)16-10-6-7-10)9-4-2-8(3-5-9)11(15)20/h2-5,10H,6-7H2,1H3,(H2,15,20)(H,16,17,18,19) |
| InChIKey | UONXFVBGTRHJDX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |