About [4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate
[4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate (PubChem CID 57173096) has the molecular formula C13H15N5O3
and a molecular weight of 289.30 g/mol. Its IUPAC name is [4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate.
Molecular Properties
| Compound Name | [4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate |
| PubChem CID | 57173096 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | [4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate |
| SMILES | COc1nc(-c2ccc(OC(N)=O)cc2)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H15N5O3/c1-18(2)12-15-10(16-13(17-12)20-3)8-4-6-9(7-5-8)21-11(14)19/h4-7H,1-3H3,(H2,14,19) |
| InChIKey | XUMWCNPMKLAHTD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate?
The IUPAC name of [4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate (CID 57173096) is [4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate.
What is the SMILES notation for [4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate?
The canonical SMILES for [4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate is COc1nc(-c2ccc(OC(N)=O)cc2)nc(N(C)C)n1.
What is the InChIKey of [4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate?
The InChIKey is XUMWCNPMKLAHTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5O3/c1-18(2)12-15-10(16-13(17-12)20-3)8-4-6-9(7-5-8)21-11(14)19/h4-7H,1-3H3,(H2,14,19).
What are the key properties of [4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate?
[4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate has a molecular weight of 289.30 g/mol, XLogP of 1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]phenyl] carbamate is sourced from PubChem (CID 57173096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).