C9H15N5O3S — CID 80789130
2-N-(1,1-dioxothian-4-yl)-6-methoxy-1,3,5-triazine-2,4-diamine (PubChem CID 80789130) has the molecular formula C9H15N5O3S and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-N-(1,1-dioxothian-4-yl)-6-methoxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(1,1-dioxothian-4-yl)-6-methoxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80789130 |
| Molecular Formula | C9H15N5O3S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-N-(1,1-dioxothian-4-yl)-6-methoxy-1,3,5-triazine-2,4-diamine |
| SMILES | COc1nc(N)nc(NC2CCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C9H15N5O3S/c1-17-9-13-7(10)12-8(14-9)11-6-2-4-18(15,16)5-3-6/h6H,2-5H2,1H3,(H3,10,11,12,13,14) |
| InChIKey | DDIVLTXBHPSWAI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |