C10H15ClN4O3S — CID 62857056
4-chloro-N-(1,1-dioxothian-4-yl)-6-ethoxy-1,3,5-triazin-2-amine (PubChem CID 62857056) has the molecular formula C10H15ClN4O3S and a molecular weight of 306.78 g/mol. Its IUPAC name is 4-chloro-N-(1,1-dioxothian-4-yl)-6-ethoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(1,1-dioxothian-4-yl)-6-ethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62857056 |
| Molecular Formula | C10H15ClN4O3S |
| Molecular Weight | 306.78 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 4-chloro-N-(1,1-dioxothian-4-yl)-6-ethoxy-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(Cl)nc(NC2CCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C10H15ClN4O3S/c1-2-18-10-14-8(11)13-9(15-10)12-7-3-5-19(16,17)6-4-7/h7H,2-6H2,1H3,(H,12,13,14,15) |
| InChIKey | XLIBDFPSZARNAO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.78 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |