C11H17ClN4O3S — CID 63924174
4-chloro-N-(1,1-dioxothian-3-yl)-6-propoxy-1,3,5-triazin-2-amine (PubChem CID 63924174) has the molecular formula C11H17ClN4O3S and a molecular weight of 320.80 g/mol. Its IUPAC name is 4-chloro-N-(1,1-dioxothian-3-yl)-6-propoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(1,1-dioxothian-3-yl)-6-propoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63924174 |
| Molecular Formula | C11H17ClN4O3S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 4-chloro-N-(1,1-dioxothian-3-yl)-6-propoxy-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(Cl)nc(NC2CCCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C11H17ClN4O3S/c1-2-5-19-11-15-9(12)14-10(16-11)13-8-4-3-6-20(17,18)7-8/h8H,2-7H2,1H3,(H,13,14,15,16) |
| InChIKey | YBJWHMYUMKPPEC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |