C11H13ClN6O2S — CID 63924548
4-chloro-N-(1,1-dioxothian-3-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 63924548) has the molecular formula C11H13ClN6O2S and a molecular weight of 328.79 g/mol. Its IUPAC name is 4-chloro-N-(1,1-dioxothian-3-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(1,1-dioxothian-3-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63924548 |
| Molecular Formula | C11H13ClN6O2S |
| Molecular Weight | 328.79 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 4-chloro-N-(1,1-dioxothian-3-yl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | O=S1(=O)CCCC(Nc2nc(Cl)nc(-n3cccn3)n2)C1 |
| InChI | InChI=1S/C11H13ClN6O2S/c12-9-15-10(14-8-3-1-6-21(19,20)7-8)17-11(16-9)18-5-2-4-13-18/h2,4-5,8H,1,3,6-7H2,(H,14,15,16,17) |
| InChIKey | NPTXFMDKUDCJMF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.79 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |