C15H27N5O — CID 80771583
2-N-cyclooctyl-4-N-methyl-6-propoxy-1,3,5-triazine-2,4-diamine (PubChem CID 80771583) has the molecular formula C15H27N5O and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-N-cyclooctyl-4-N-methyl-6-propoxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-cyclooctyl-4-N-methyl-6-propoxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80771583 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 2-N-cyclooctyl-4-N-methyl-6-propoxy-1,3,5-triazine-2,4-diamine |
| SMILES | CCCOc1nc(NC)nc(NC2CCCCCCC2)n1 |
| InChI | InChI=1S/C15H27N5O/c1-3-11-21-15-19-13(16-2)18-14(20-15)17-12-9-7-5-4-6-8-10-12/h12H,3-11H2,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | MBLIJXUISKUCOF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |