C12H17Cl2N3O2S — CID 102758408
3,5-dichloro-6-N-(1,1-dioxothian-3-yl)-2-N-ethylpyridine-2,6-diamine (PubChem CID 102758408) has the molecular formula C12H17Cl2N3O2S and a molecular weight of 338.26 g/mol. Its IUPAC name is 3,5-dichloro-6-N-(1,1-dioxothian-3-yl)-2-N-ethylpyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-(1,1-dioxothian-3-yl)-2-N-ethylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 102758408 |
| Molecular Formula | C12H17Cl2N3O2S |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 3,5-dichloro-6-N-(1,1-dioxothian-3-yl)-2-N-ethylpyridine-2,6-diamine |
| SMILES | CCNc1nc(NC2CCCS(=O)(=O)C2)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2N3O2S/c1-2-15-11-9(13)6-10(14)12(17-11)16-8-4-3-5-20(18,19)7-8/h6,8H,2-5,7H2,1H3,(H2,15,16,17) |
| InChIKey | BQKUTKTYVFOKFD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |