C13H19Cl2N3S — CID 102759994
3,5-dichloro-2-N-propyl-6-N-(thian-3-yl)pyridine-2,6-diamine (PubChem CID 102759994) has the molecular formula C13H19Cl2N3S and a molecular weight of 320.29 g/mol. Its IUPAC name is 3,5-dichloro-2-N-propyl-6-N-(thian-3-yl)pyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-2-N-propyl-6-N-(thian-3-yl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102759994 |
| Molecular Formula | C13H19Cl2N3S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3,5-dichloro-2-N-propyl-6-N-(thian-3-yl)pyridine-2,6-diamine |
| SMILES | CCCNc1nc(NC2CCCSC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl2N3S/c1-2-5-16-12-10(14)7-11(15)13(18-12)17-9-4-3-6-19-8-9/h7,9H,2-6,8H2,1H3,(H2,16,17,18) |
| InChIKey | RJXBSKHAHZWCIW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |