C13H19Cl2N3O — CID 102756272
3,5-dichloro-6-N-(oxan-4-yl)-2-N-propylpyridine-2,6-diamine (PubChem CID 102756272) has the molecular formula C13H19Cl2N3O and a molecular weight of 304.22 g/mol. Its IUPAC name is 3,5-dichloro-6-N-(oxan-4-yl)-2-N-propylpyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-(oxan-4-yl)-2-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 102756272 |
| Molecular Formula | C13H19Cl2N3O |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 3,5-dichloro-6-N-(oxan-4-yl)-2-N-propylpyridine-2,6-diamine |
| SMILES | CCCNc1nc(NC2CCOCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl2N3O/c1-2-5-16-12-10(14)8-11(15)13(18-12)17-9-3-6-19-7-4-9/h8-9H,2-7H2,1H3,(H2,16,17,18) |
| InChIKey | XTTRMHOXENBFSB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |