C11H17N3O4S — CID 115354965
N-(1,1-dioxothian-4-yl)-4,6-dimethoxypyrimidin-2-amine (PubChem CID 115354965) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-4,6-dimethoxypyrimidin-2-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-4,6-dimethoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 115354965 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-4,6-dimethoxypyrimidin-2-amine |
| SMILES | COc1cc(OC)nc(NC2CCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C11H17N3O4S/c1-17-9-7-10(18-2)14-11(13-9)12-8-3-5-19(15,16)6-4-8/h7-8H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | OELJOHRGDBXYOM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |