C18H17N5O2 — CID 58205198
N-(4-anilino-6-methoxy-1,3,5-triazin-2-yl)-4-methylbenzamide (PubChem CID 58205198) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is N-(4-anilino-6-methoxy-1,3,5-triazin-2-yl)-4-methylbenzamide.
| Compound Name | N-(4-anilino-6-methoxy-1,3,5-triazin-2-yl)-4-methylbenzamide |
|---|---|
| PubChem CID | 58205198 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-(4-anilino-6-methoxy-1,3,5-triazin-2-yl)-4-methylbenzamide |
| SMILES | COc1nc(NC(=O)c2ccc(C)cc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C18H17N5O2/c1-12-8-10-13(11-9-12)15(24)20-17-21-16(22-18(23-17)25-2)19-14-6-4-3-5-7-14/h3-11H,1-2H3,(H2,19,20,21,22,23,24) |
| InChIKey | UQVOETJZGXJGQK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |