C18H16N4O2 — CID 117089057
1-[3-(4-anilino-6-methoxy-1,3,5-triazin-2-yl)phenyl]ethanone (PubChem CID 117089057) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-[3-(4-anilino-6-methoxy-1,3,5-triazin-2-yl)phenyl]ethanone.
| Compound Name | 1-[3-(4-anilino-6-methoxy-1,3,5-triazin-2-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 117089057 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[3-(4-anilino-6-methoxy-1,3,5-triazin-2-yl)phenyl]ethanone |
| SMILES | COc1nc(Nc2ccccc2)nc(-c2cccc(C(C)=O)c2)n1 |
| InChI | InChI=1S/C18H16N4O2/c1-12(23)13-7-6-8-14(11-13)16-20-17(22-18(21-16)24-2)19-15-9-4-3-5-10-15/h3-11H,1-2H3,(H,19,20,21,22) |
| InChIKey | NYDGAZNIOMAXIO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |