C22H18N4O2 — CID 136603035
2-(4-anilino-6-phenyl-1,3,5-triazin-2-yl)-5-methoxyphenol (PubChem CID 136603035) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-(4-anilino-6-phenyl-1,3,5-triazin-2-yl)-5-methoxyphenol.
| Compound Name | 2-(4-anilino-6-phenyl-1,3,5-triazin-2-yl)-5-methoxyphenol |
|---|---|
| PubChem CID | 136603035 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-(4-anilino-6-phenyl-1,3,5-triazin-2-yl)-5-methoxyphenol |
| SMILES | COc1ccc(-c2nc(Nc3ccccc3)nc(-c3ccccc3)n2)c(O)c1 |
| InChI | InChI=1S/C22H18N4O2/c1-28-17-12-13-18(19(27)14-17)21-24-20(15-8-4-2-5-9-15)25-22(26-21)23-16-10-6-3-7-11-16/h2-14,27H,1H3,(H,23,24,25,26) |
| InChIKey | PNSDPCPTYRYNIL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |