C23H19N3O4 — CID 143193670
4-[4-(2-hydroxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]-2,6-dimethoxyphenol (PubChem CID 143193670) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 4-[4-(2-hydroxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]-2,6-dimethoxyphenol.
| Compound Name | 4-[4-(2-hydroxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 143193670 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-[4-(2-hydroxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3O)n2)cc(OC)c1O |
| InChI | InChI=1S/C23H19N3O4/c1-29-18-12-15(13-19(30-2)20(18)28)22-24-21(14-8-4-3-5-9-14)25-23(26-22)16-10-6-7-11-17(16)27/h3-13,27-28H,1-2H3 |
| InChIKey | MCYMVGGSFKCCKL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |