C67H48N6O7 — CID 136632194
4-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]benzene-1,3-diol;2-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]-5-methylphenol (PubChem CID 136632194) has the molecular formula C67H48N6O7 and a molecular weight of 1049.16 g/mol. Its IUPAC name is 4-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]benzene-1,3-diol;2-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]-5-methylphenol.
| Compound Name | 4-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]benzene-1,3-diol;2-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]-5-methylphenol |
|---|---|
| PubChem CID | 136632194 |
| Molecular Formula | C67H48N6O7 |
| Molecular Weight | 1049.16 g/mol |
| Exact Mass | 1048.36 |
| IUPAC Name | 4-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]benzene-1,3-diol;2-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]-5-methylphenol |
| SMILES | Cc1ccc(-c2nc(-c3ccc(Oc4ccccc4)cc3)nc(-c3ccc(Oc4ccccc4)cc3)n2)c(O)c1.Oc1ccc(-c2nc(-c3ccc(Oc4ccccc4)cc3)nc(-c3ccc(Oc4ccccc4)cc3)n2)c(O)c1 |
| InChI | InChI=1S/C34H25N3O3.C33H23N3O4/c1-23-12-21-30(31(38)22-23)34-36-32(24-13-17-28(18-14-24)39-26-8-4-2-5-9-26)35-33(37-34)25-15-19-29(20-16-25)40-27-10-6-3-7-11-27;37-24-15-20-29(30(38)21-24)33-35-31(22-11-16-27(17-12-22)39-25-7-3-1-4-8-25)34-32(36-33)23-13-18-28(19-14-23)40-26-9-5-2-6-10-26/h2-22,38H,1H3;1-21,37-38H |
| InChIKey | RMASNDCYTXUIPV-UHFFFAOYSA-N |
| XLogP | 16.34 |
| TPSA | 174.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.16 |
| LogP ≤ 5 | 16.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |