C24H20N4O4 — CID 86729978
ethyl 4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)amino]benzoate (PubChem CID 86729978) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is ethyl 4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)amino]benzoate.
| Compound Name | ethyl 4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 86729978 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | ethyl 4-[(4,6-diphenoxy-1,3,5-triazin-2-yl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(Oc3ccccc3)nc(Oc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H20N4O4/c1-2-30-21(29)17-13-15-18(16-14-17)25-22-26-23(31-19-9-5-3-6-10-19)28-24(27-22)32-20-11-7-4-8-12-20/h3-16H,2H2,1H3,(H,25,26,27,28) |
| InChIKey | PUOLNJCEILBTCW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |