C21H18N4O3 — CID 70924888
ethyl 4-[(4-amino-5-cyano-6-phenoxy-2-pyridinyl)amino]benzoate (PubChem CID 70924888) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is ethyl 4-[(4-amino-5-cyano-6-phenoxy-2-pyridinyl)amino]benzoate.
| Compound Name | ethyl 4-[(4-amino-5-cyano-6-phenoxy-2-pyridinyl)amino]benzoate |
|---|---|
| PubChem CID | 70924888 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | ethyl 4-[(4-amino-5-cyano-6-phenoxy-2-pyridinyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2cc(N)c(C#N)c(Oc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H18N4O3/c1-2-27-21(26)14-8-10-15(11-9-14)24-19-12-18(23)17(13-22)20(25-19)28-16-6-4-3-5-7-16/h3-12H,2H2,1H3,(H3,23,24,25) |
| InChIKey | YVXIBSWSUVQXOE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |