C19H16N4O3S — CID 143926924
4-amino-6-(4-methylsulfonylanilino)-2-phenoxypyridine-3-carbonitrile (PubChem CID 143926924) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-amino-6-(4-methylsulfonylanilino)-2-phenoxypyridine-3-carbonitrile.
| Compound Name | 4-amino-6-(4-methylsulfonylanilino)-2-phenoxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 143926924 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 4-amino-6-(4-methylsulfonylanilino)-2-phenoxypyridine-3-carbonitrile |
| SMILES | CS(=O)(=O)c1ccc(Nc2cc(N)c(C#N)c(Oc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H16N4O3S/c1-27(24,25)15-9-7-13(8-10-15)22-18-11-17(21)16(12-20)19(23-18)26-14-5-3-2-4-6-14/h2-11H,1H3,(H3,21,22,23) |
| InChIKey | IYAUDSGNBIYHFO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |