C23H24N6O — CID 143926928
4-amino-2-phenoxy-6-[4-(piperazin-1-ylmethyl)anilino]pyridine-3-carbonitrile (PubChem CID 143926928) has the molecular formula C23H24N6O and a molecular weight of 400.49 g/mol. Its IUPAC name is 4-amino-2-phenoxy-6-[4-(piperazin-1-ylmethyl)anilino]pyridine-3-carbonitrile.
| Compound Name | 4-amino-2-phenoxy-6-[4-(piperazin-1-ylmethyl)anilino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 143926928 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 4-amino-2-phenoxy-6-[4-(piperazin-1-ylmethyl)anilino]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(N)cc(Nc2ccc(CN3CCNCC3)cc2)nc1Oc1ccccc1 |
| InChI | InChI=1S/C23H24N6O/c24-15-20-21(25)14-22(28-23(20)30-19-4-2-1-3-5-19)27-18-8-6-17(7-9-18)16-29-12-10-26-11-13-29/h1-9,14,26H,10-13,16H2,(H3,25,27,28) |
| InChIKey | DBIBQLAUQMUWBN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |