C25H20N4O4 — CID 12025852
ethyl 4-[(5-nitro-4,6-diphenylpyrimidin-2-yl)amino]benzoate (PubChem CID 12025852) has the molecular formula C25H20N4O4 and a molecular weight of 440.46 g/mol. Its IUPAC name is ethyl 4-[(5-nitro-4,6-diphenylpyrimidin-2-yl)amino]benzoate.
| Compound Name | ethyl 4-[(5-nitro-4,6-diphenylpyrimidin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 12025852 |
| Molecular Formula | C25H20N4O4 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | ethyl 4-[(5-nitro-4,6-diphenylpyrimidin-2-yl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(-c3ccccc3)c([N+](=O)[O-])c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H20N4O4/c1-2-33-24(30)19-13-15-20(16-14-19)26-25-27-21(17-9-5-3-6-10-17)23(29(31)32)22(28-25)18-11-7-4-8-12-18/h3-16H,2H2,1H3,(H,26,27,28) |
| InChIKey | ANHFFMKEKGAPQI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|