C20H17N7O7 — CID 22528939
ethyl 4-[[5-nitro-6-[2-(2-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate (PubChem CID 22528939) has the molecular formula C20H17N7O7 and a molecular weight of 467.40 g/mol. Its IUPAC name is ethyl 4-[[5-nitro-6-[2-(2-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 4-[[5-nitro-6-[2-(2-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22528939 |
| Molecular Formula | C20H17N7O7 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | ethyl 4-[[5-nitro-6-[2-(2-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ncnc(NNC(=O)c3ccccc3[N+](=O)[O-])c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H17N7O7/c1-2-34-20(29)12-7-9-13(10-8-12)23-17-16(27(32)33)18(22-11-21-17)24-25-19(28)14-5-3-4-6-15(14)26(30)31/h3-11H,2H2,1H3,(H,25,28)(H2,21,22,23,24) |
| InChIKey | KZGPZTYYOPWGDX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 191.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|