C21H20N6O6 — CID 22528950
ethyl 4-[[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22528950) has the molecular formula C21H20N6O6 and a molecular weight of 452.43 g/mol. Its IUPAC name is ethyl 4-[[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 4-[[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22528950 |
| Molecular Formula | C21H20N6O6 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | ethyl 4-[[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ncnc(NNC(=O)c3ccc(OC)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H20N6O6/c1-3-33-21(29)14-4-8-15(9-5-14)24-18-17(27(30)31)19(23-12-22-18)25-26-20(28)13-6-10-16(32-2)11-7-13/h4-12H,3H2,1-2H3,(H,26,28)(H2,22,23,24,25) |
| InChIKey | MDNBDCKMWXWDNA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 157.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|