C19H23FN4O7S — CID 129202343
tert-butyl N-[(8aS)-4a-(2-fluoro-5-nitrophenyl)-2-methyl-1,1,7-trioxo-5,6,8,8a-tetrahydro-1λ6,2,4-benzothiadiazin-3-yl]carbamate (PubChem CID 129202343) has the molecular formula C19H23FN4O7S and a molecular weight of 470.48 g/mol. Its IUPAC name is tert-butyl N-[(8aS)-4a-(2-fluoro-5-nitrophenyl)-2-methyl-1,1,7-trioxo-5,6,8,8a-tetrahydro-1λ6,2,4-benzothiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(8aS)-4a-(2-fluoro-5-nitrophenyl)-2-methyl-1,1,7-trioxo-5,6,8,8a-tetrahydro-1λ6,2,4-benzothiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 129202343 |
| Molecular Formula | C19H23FN4O7S |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | tert-butyl N-[(8aS)-4a-(2-fluoro-5-nitrophenyl)-2-methyl-1,1,7-trioxo-5,6,8,8a-tetrahydro-1λ6,2,4-benzothiadiazin-3-yl]carbamate |
| SMILES | CN1C(NC(=O)OC(C)(C)C)=NC2(c3cc([N+](=O)[O-])ccc3F)CCC(=O)C[C@@H]2S1(=O)=O |
| InChI | InChI=1S/C19H23FN4O7S/c1-18(2,3)31-17(26)21-16-22-19(13-9-11(24(27)28)5-6-14(13)20)8-7-12(25)10-15(19)32(29,30)23(16)4/h5-6,9,15H,7-8,10H2,1-4H3,(H,21,22,26)/t15-,19?/m0/s1 |
| InChIKey | MFXPOENOBMVIKL-FUKCDUGKSA-N |
| XLogP | 2.21 |
| TPSA | 148.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|