C21H22FN7O3S — CID 129201643
(4aR,7aR)-4a-[2-fluoro-5-[(2-methoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-amine (PubChem CID 129201643) has the molecular formula C21H22FN7O3S and a molecular weight of 471.52 g/mol. Its IUPAC name is (4aR,7aR)-4a-[2-fluoro-5-[(2-methoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-amine.
| Compound Name | (4aR,7aR)-4a-[2-fluoro-5-[(2-methoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-amine |
|---|---|
| PubChem CID | 129201643 |
| Molecular Formula | C21H22FN7O3S |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | (4aR,7aR)-4a-[2-fluoro-5-[(2-methoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-amine |
| SMILES | COc1cnc2c(Nc3ccc(F)c([C@]45CCC[C@H]4S(=O)(=O)N(C)C(N)=N5)c3)nccc2n1 |
| InChI | InChI=1S/C21H22FN7O3S/c1-29-20(23)28-21(8-3-4-16(21)33(29,30)31)13-10-12(5-6-14(13)22)26-19-18-15(7-9-24-19)27-17(32-2)11-25-18/h5-7,9-11,16H,3-4,8H2,1-2H3,(H2,23,28)(H,24,26)/t16-,21-/m1/s1 |
| InChIKey | XPAQUQVFMRPMDY-IIBYNOLFSA-N |
| XLogP | 2.25 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |